C31H39N3O3 — CID 14307831
(8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 14307831) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is (8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 14307831 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | (8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)C(=O)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C31H39N3O3/c1-21-18-26-24-8-7-22-19-23(35)9-11-29(22,2)25(24)10-12-30(26,3)31(21,37)27(36)20-33-14-16-34(17-15-33)28-6-4-5-13-32-28/h4-6,9-11,13,19,21,24,26,37H,7-8,12,14-18,20H2,1-3H3/t21-,24-,26+,29+,30+,31+/m1/s1 |
| InChIKey | YPNIBWQBTDGMDQ-PMXIZSLMSA-N |
| XLogP | 3.98 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|