C26H38N4O3 — CID 143082763
(2S)-1-[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]-N-[(3Z,5Z)-1-phenylocta-3,5-dienyl]pyrrolidine-2-carboxamide (PubChem CID 143082763) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is (2S)-1-[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]-N-[(3Z,5Z)-1-phenylocta-3,5-dienyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]-N-[(3Z,5Z)-1-phenylocta-3,5-dienyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143082763 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (2S)-1-[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]-N-[(3Z,5Z)-1-phenylocta-3,5-dienyl]pyrrolidine-2-carboxamide |
| SMILES | CC/C=C\C=C/CC(NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)CN)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H38N4O3/c1-4-5-6-7-11-15-21(20-13-9-8-10-14-20)28-25(32)22-16-12-17-30(22)26(33)24(19(2)3)29-23(31)18-27/h5-11,13-14,19,21-22,24H,4,12,15-18,27H2,1-3H3,(H,28,32)(H,29,31)/b6-5-,11-7-/t21?,22-,24?/m0/s1 |
| InChIKey | PPRBPNKKTZSQHX-CNZAHSBUSA-N |
| XLogP | 2.85 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|