C35H33F3N4O4 — CID 143083849
6-[6-hydroxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]oxy-N-[2-methyl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 143083849) has the molecular formula C35H33F3N4O4 and a molecular weight of 630.67 g/mol. Its IUPAC name is 6-[6-hydroxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]oxy-N-[2-methyl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-[6-hydroxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]oxy-N-[2-methyl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 143083849 |
| Molecular Formula | C35H33F3N4O4 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 6-[6-hydroxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]oxy-N-[2-methyl-3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | Cc1c(NC(=O)c2cccc3cc(Oc4ncnc5cc(OCCCN6CCCCC6)c(O)cc45)ccc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C35H33F3N4O4/c1-22-28(35(36,37)38)10-6-11-29(22)41-33(44)26-9-5-8-23-18-24(12-13-25(23)26)46-34-27-19-31(43)32(20-30(27)39-21-40-34)45-17-7-16-42-14-3-2-4-15-42/h5-6,8-13,18-21,43H,2-4,7,14-17H2,1H3,(H,41,44) |
| InChIKey | WPFYWCJPIOVLJH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|