C20H23N5OS — CID 143084187
N-cyclopropyl-4-methyl-3-[3-(propylsulfanylamino)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide (PubChem CID 143084187) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[3-(propylsulfanylamino)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[3-(propylsulfanylamino)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 143084187 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[3-(propylsulfanylamino)-2H-pyrazolo[3,4-b]pyridin-6-yl]benzamide |
| SMILES | CCCSNc1[nH]nc2nc(-c3cc(C(=O)NC4CC4)ccc3C)ccc12 |
| InChI | InChI=1S/C20H23N5OS/c1-3-10-27-25-19-15-8-9-17(22-18(15)23-24-19)16-11-13(5-4-12(16)2)20(26)21-14-6-7-14/h4-5,8-9,11,14H,3,6-7,10H2,1-2H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | JAKWYQCPBWGTFY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|