C21H29N3OS — CID 143084232
N-cyclohexyl-4-methyl-3-(4-methylpenta-1,4-dien-2-ylcarbamothioylamino)benzamide (PubChem CID 143084232) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-3-(4-methylpenta-1,4-dien-2-ylcarbamothioylamino)benzamide.
| Compound Name | N-cyclohexyl-4-methyl-3-(4-methylpenta-1,4-dien-2-ylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 143084232 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-cyclohexyl-4-methyl-3-(4-methylpenta-1,4-dien-2-ylcarbamothioylamino)benzamide |
| SMILES | C=C(C)CC(=C)NC(=S)Nc1cc(C(=O)NC2CCCCC2)ccc1C |
| InChI | InChI=1S/C21H29N3OS/c1-14(2)12-16(4)22-21(26)24-19-13-17(11-10-15(19)3)20(25)23-18-8-6-5-7-9-18/h10-11,13,18H,1,4-9,12H2,2-3H3,(H,23,25)(H2,22,24,26) |
| InChIKey | PVDKUCGZUMLOOC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|