C33H35N3O6 — CID 143084910
(1Z,4R,6S,7Z,15R)-2-hydroxy-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-14-oxo-3,13-diazatricyclo[13.3.0.04,6]octadeca-1,7-diene-4-carboxylic acid (PubChem CID 143084910) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is (1Z,4R,6S,7Z,15R)-2-hydroxy-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-14-oxo-3,13-diazatricyclo[13.3.0.04,6]octadeca-1,7-diene-4-carboxylic acid.
| Compound Name | (1Z,4R,6S,7Z,15R)-2-hydroxy-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-14-oxo-3,13-diazatricyclo[13.3.0.04,6]octadeca-1,7-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 143084910 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | (1Z,4R,6S,7Z,15R)-2-hydroxy-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-14-oxo-3,13-diazatricyclo[13.3.0.04,6]octadeca-1,7-diene-4-carboxylic acid |
| SMILES | COc1ccc2c(OC3C/C4=C(/O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCNC(=O)[C@@H]4C3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C33H35N3O6/c1-41-22-12-13-24-28(17-22)35-27(20-9-5-4-6-10-20)18-29(24)42-23-15-25-26(16-23)31(38)36-33(32(39)40)19-21(33)11-7-2-3-8-14-34-30(25)37/h4-7,9-13,17-18,21,23,25,36,38H,2-3,8,14-16,19H2,1H3,(H,34,37)(H,39,40)/b11-7-,31-26-/t21-,23?,25-,33-/m1/s1 |
| InChIKey | JPBFSWYFEKOSST-KJRIJVEOSA-N |
| XLogP | 5.13 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|