C35H40N4O6 — CID 70317024
(1R,4R,6S,7Z,15R,17R)-13-(dimethylamino)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 70317024) has the molecular formula C35H40N4O6 and a molecular weight of 612.73 g/mol. Its IUPAC name is (1R,4R,6S,7Z,15R,17R)-13-(dimethylamino)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1R,4R,6S,7Z,15R,17R)-13-(dimethylamino)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 70317024 |
| Molecular Formula | C35H40N4O6 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | (1R,4R,6S,7Z,15R,17R)-13-(dimethylamino)-17-(7-methoxy-2-phenylquinolin-4-yl)oxy-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCN(N(C)C)C(=O)[C@@H]4C3)cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C35H40N4O6/c1-38(2)39-16-10-5-4-9-13-23-21-35(23,34(42)43)37-32(40)27-17-25(18-28(27)33(39)41)45-31-20-29(22-11-7-6-8-12-22)36-30-19-24(44-3)14-15-26(30)31/h6-9,11-15,19-20,23,25,27-28H,4-5,10,16-18,21H2,1-3H3,(H,37,40)(H,42,43)/b13-9-/t23-,25-,27-,28-,35-/m1/s1 |
| InChIKey | HRBBMILADVCODS-KEESKCSESA-N |
| XLogP | 4.69 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|