C30H36N4O7 — CID 59312858
(1R,4R,6R,7Z,15R,17R)-17-[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 59312858) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is (1R,4R,6R,7Z,15R,17R)-17-[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1R,4R,6R,7Z,15R,17R)-17-[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 59312858 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (1R,4R,6R,7Z,15R,17R)-17-[2-methoxy-6-(3-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1cccc(-c2cc(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@@H]5/C=C\CCCCN(C)C(=O)[C@@H]4C3)nc(OC)n2)c1 |
| InChI | InChI=1S/C30H36N4O7/c1-34-12-7-5-4-6-10-19-17-30(19,28(37)38)33-26(35)22-14-21(15-23(22)27(34)36)41-25-16-24(31-29(32-25)40-3)18-9-8-11-20(13-18)39-2/h6,8-11,13,16,19,21-23H,4-5,7,12,14-15,17H2,1-3H3,(H,33,35)(H,37,38)/b10-6-/t19-,21+,22+,23+,30+/m0/s1 |
| InChIKey | JHABONHXNJZHOA-GUHHJLCMSA-N |
| XLogP | 3.09 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|