C28H33N5O6 — CID 70881266
(1S,4R,6S,7Z,17R)-17-(2-methoxy-6-phenylpyrimidin-4-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 70881266) has the molecular formula C28H33N5O6 and a molecular weight of 535.60 g/mol. Its IUPAC name is (1S,4R,6S,7Z,17R)-17-(2-methoxy-6-phenylpyrimidin-4-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,6S,7Z,17R)-17-(2-methoxy-6-phenylpyrimidin-4-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 70881266 |
| Molecular Formula | C28H33N5O6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (1S,4R,6S,7Z,17R)-17-(2-methoxy-6-phenylpyrimidin-4-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1nc(O[C@@H]2C[C@H]3C(=O)N[C@]4(C(=O)O)C[C@H]4/C=C\CCCCN(C)C(=O)N3C2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H33N5O6/c1-32-13-9-4-3-8-12-19-16-28(19,25(35)36)31-24(34)22-14-20(17-33(22)27(32)37)39-23-15-21(29-26(30-23)38-2)18-10-6-5-7-11-18/h5-8,10-12,15,19-20,22H,3-4,9,13-14,16-17H2,1-2H3,(H,31,34)(H,35,36)/b12-8-/t19-,20-,22+,28-/m1/s1 |
| InChIKey | AQMSNWSHBNQICX-RIDIFBSZSA-N |
| XLogP | 2.73 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|