C27H31BrN4O6 — CID 67387166
17-(4-bromo-6-methoxyisoquinolin-1-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 67387166) has the molecular formula C27H31BrN4O6 and a molecular weight of 587.47 g/mol. Its IUPAC name is 17-(4-bromo-6-methoxyisoquinolin-1-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | 17-(4-bromo-6-methoxyisoquinolin-1-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 67387166 |
| Molecular Formula | C27H31BrN4O6 |
| Molecular Weight | 587.47 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 17-(4-bromo-6-methoxyisoquinolin-1-yl)oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(OC3CC4C(=O)NC5(C(=O)O)CC5C=CCCCCN(C)C(=O)N4C3)ncc(Br)c2c1 |
| InChI | InChI=1S/C27H31BrN4O6/c1-31-10-6-4-3-5-7-16-13-27(16,25(34)35)30-23(33)22-12-18(15-32(22)26(31)36)38-24-19-9-8-17(37-2)11-20(19)21(28)14-29-24/h5,7-9,11,14,16,18,22H,3-4,6,10,12-13,15H2,1-2H3,(H,30,33)(H,34,35) |
| InChIKey | QONOTMACYLYSTL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|