C26H28ClN3O7 — CID 73231857
17-(3-chloro-6-methoxyisoquinolin-1-yl)oxy-2,14-dioxo-13-oxa-3,15-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 73231857) has the molecular formula C26H28ClN3O7 and a molecular weight of 529.98 g/mol. Its IUPAC name is 17-(3-chloro-6-methoxyisoquinolin-1-yl)oxy-2,14-dioxo-13-oxa-3,15-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | 17-(3-chloro-6-methoxyisoquinolin-1-yl)oxy-2,14-dioxo-13-oxa-3,15-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 73231857 |
| Molecular Formula | C26H28ClN3O7 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 17-(3-chloro-6-methoxyisoquinolin-1-yl)oxy-2,14-dioxo-13-oxa-3,15-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(OC3CC4C(=O)NC5(C(=O)O)CC5C=CCCCCOC(=O)N4C3)nc(Cl)cc2c1 |
| InChI | InChI=1S/C26H28ClN3O7/c1-35-17-7-8-19-15(10-17)11-21(27)28-23(19)37-18-12-20-22(31)29-26(24(32)33)13-16(26)6-4-2-3-5-9-36-25(34)30(20)14-18/h4,6-8,10-11,16,18,20H,2-3,5,9,12-14H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | XQNSGMJILVCEJU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|