C33H39N5O6S — CID 90939519
(1S,4R,6S,17R)-17-[6-methoxy-3-(4-propan-2-yl-1,3-thiazol-2-yl)isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 90939519) has the molecular formula C33H39N5O6S and a molecular weight of 633.77 g/mol. Its IUPAC name is (1S,4R,6S,17R)-17-[6-methoxy-3-(4-propan-2-yl-1,3-thiazol-2-yl)isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,6S,17R)-17-[6-methoxy-3-(4-propan-2-yl-1,3-thiazol-2-yl)isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90939519 |
| Molecular Formula | C33H39N5O6S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | (1S,4R,6S,17R)-17-[6-methoxy-3-(4-propan-2-yl-1,3-thiazol-2-yl)isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13,15-triazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5C=CCCCCN(C)C(=O)N4C3)nc(-c3nc(C(C)C)cs3)cc2c1 |
| InChI | InChI=1S/C33H39N5O6S/c1-19(2)26-18-45-30(35-26)25-14-20-13-22(43-4)10-11-24(20)29(34-25)44-23-15-27-28(39)36-33(31(40)41)16-21(33)9-7-5-6-8-12-37(3)32(42)38(27)17-23/h7,9-11,13-14,18-19,21,23,27H,5-6,8,12,15-17H2,1-4H3,(H,36,39)(H,40,41)/t21-,23-,27+,33-/m1/s1 |
| InChIKey | KXPDADJSCZZXFI-BWJNHWFTSA-N |
| XLogP | 5.06 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|