C34H41N5O6S — CID 88896439
(1R,4R,6S,7Z,15R,17R)-17-[6-methoxy-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 88896439) has the molecular formula C34H41N5O6S and a molecular weight of 647.80 g/mol. Its IUPAC name is (1R,4R,6S,7Z,15R,17R)-17-[6-methoxy-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1R,4R,6S,7Z,15R,17R)-17-[6-methoxy-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 88896439 |
| Molecular Formula | C34H41N5O6S |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.28 |
| IUPAC Name | (1R,4R,6S,7Z,15R,17R)-17-[6-methoxy-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]isoquinolin-1-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCN(C)C(=O)[C@@H]4C3)nc(-c3csc(NC(C)C)n3)cc2c1 |
| InChI | InChI=1S/C34H41N5O6S/c1-19(2)35-33-37-28(18-46-33)27-14-20-13-22(44-4)10-11-24(20)30(36-27)45-23-15-25-26(16-23)31(41)39(3)12-8-6-5-7-9-21-17-34(21,32(42)43)38-29(25)40/h7,9-11,13-14,18-19,21,23,25-26H,5-6,8,12,15-17H2,1-4H3,(H,35,37)(H,38,40)(H,42,43)/b9-7-/t21-,23-,25-,26-,34-/m1/s1 |
| InChIKey | QGHASORNNOGEJO-RZFUKJJXSA-N |
| XLogP | 5.12 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|