C34H37FN4O6 — CID 90730319
(1R,4R,6S,17R)-17-[2-(4-fluorophenyl)-7-methoxy-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 90730319) has the molecular formula C34H37FN4O6 and a molecular weight of 616.69 g/mol. Its IUPAC name is (1R,4R,6S,17R)-17-[2-(4-fluorophenyl)-7-methoxy-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1R,4R,6S,17R)-17-[2-(4-fluorophenyl)-7-methoxy-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90730319 |
| Molecular Formula | C34H37FN4O6 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | (1R,4R,6S,17R)-17-[2-(4-fluorophenyl)-7-methoxy-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@H]3CC4C(=O)N(C)CCCCC=C[C@@H]5C[C@@]5(C(=O)O)NC(=O)[C@@H]4C3)nc(-c3ccc(F)cc3)nc2c1C |
| InChI | InChI=1S/C34H37FN4O6/c1-19-27(44-3)14-13-24-28(19)36-29(20-9-11-22(35)12-10-20)37-31(24)45-23-16-25-26(17-23)32(41)39(2)15-7-5-4-6-8-21-18-34(21,33(42)43)38-30(25)40/h6,8-14,21,23,25-26H,4-5,7,15-18H2,1-3H3,(H,38,40)(H,42,43)/t21-,23-,25-,26?,34-/m1/s1 |
| InChIKey | KKBDXRPQILGPFO-XUOAPAPMSA-N |
| XLogP | 4.68 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|