C37H44N4O7 — CID 70320058
ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-2-(4-methoxyphenyl)-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 70320058) has the molecular formula C37H44N4O7 and a molecular weight of 656.78 g/mol. Its IUPAC name is ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-2-(4-methoxyphenyl)-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-2-(4-methoxyphenyl)-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 70320058 |
| Molecular Formula | C37H44N4O7 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-2-(4-methoxyphenyl)-8-methylquinazolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCCN(C)C(=O)[C@@H]1C[C@H](Oc3nc(-c4ccc(OC)cc4)nc4c(C)c(OC)ccc34)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C37H44N4O7/c1-6-47-36(44)37-21-24(37)11-9-7-8-10-18-41(3)35(43)29-20-26(19-28(29)33(42)40-37)48-34-27-16-17-30(46-5)22(2)31(27)38-32(39-34)23-12-14-25(45-4)15-13-23/h9,11-17,24,26,28-29H,6-8,10,18-21H2,1-5H3,(H,40,42)/b11-9-/t24-,26-,28-,29-,37-/m1/s1 |
| InChIKey | BBOWNYXBZYVHNL-UURWFAIBSA-N |
| XLogP | 5.03 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|