C39H48N4O6 — CID 66908394
ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-8-methyl-2-(6-propan-2-yl-2-pyridinyl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 66908394) has the molecular formula C39H48N4O6 and a molecular weight of 668.84 g/mol. Its IUPAC name is ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-8-methyl-2-(6-propan-2-yl-2-pyridinyl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-8-methyl-2-(6-propan-2-yl-2-pyridinyl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 66908394 |
| Molecular Formula | C39H48N4O6 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[7-methoxy-8-methyl-2-(6-propan-2-yl-2-pyridinyl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCCN(C)C(=O)[C@@H]1C[C@H](Oc3cc(-c4cccc(C(C)C)n4)nc4c(C)c(OC)ccc34)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C39H48N4O6/c1-7-48-38(46)39-22-25(39)13-10-8-9-11-18-43(5)37(45)29-20-26(19-28(29)36(44)42-39)49-34-21-32(31-15-12-14-30(40-31)23(2)3)41-35-24(4)33(47-6)17-16-27(34)35/h10,12-17,21,23,25-26,28-29H,7-9,11,18-20,22H2,1-6H3,(H,42,44)/b13-10-/t25-,26-,28-,29-,39-/m1/s1 |
| InChIKey | DNYPOMZQDJFRIE-ZSAPEQOUSA-N |
| XLogP | 6.15 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|