C32H40N4O7 — CID 70881313
ethyl (1R,4R,6S,7Z,15R,17R)-17-[2-methoxy-6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate (PubChem CID 70881313) has the molecular formula C32H40N4O7 and a molecular weight of 592.69 g/mol. Its IUPAC name is ethyl (1R,4R,6S,7Z,15R,17R)-17-[2-methoxy-6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[2-methoxy-6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 70881313 |
| Molecular Formula | C32H40N4O7 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | ethyl (1R,4R,6S,7Z,15R,17R)-17-[2-methoxy-6-(4-methoxyphenyl)pyrimidin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\CCCCN(C)C(=O)[C@@H]1C[C@H](Oc3cc(-c4ccc(OC)cc4)nc(OC)n3)C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C32H40N4O7/c1-5-42-30(39)32-19-21(32)10-8-6-7-9-15-36(2)29(38)25-17-23(16-24(25)28(37)35-32)43-27-18-26(33-31(34-27)41-4)20-11-13-22(40-3)14-12-20/h8,10-14,18,21,23-25H,5-7,9,15-17,19H2,1-4H3,(H,35,37)/b10-8-/t21-,23-,24-,25-,32-/m1/s1 |
| InChIKey | ARHJHTPSXHDVIO-LGSVEIJMSA-N |
| XLogP | 3.57 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|