C24H47N3S — CID 143088073
N-[[5-[(E)-but-2-en-2-yl]-1,3-thiazol-2-yl]methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine;ethane;prop-1-ene (PubChem CID 143088073) has the molecular formula C24H47N3S and a molecular weight of 409.73 g/mol. Its IUPAC name is N-[[5-[(E)-but-2-en-2-yl]-1,3-thiazol-2-yl]methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine;ethane;prop-1-ene.
| Compound Name | N-[[5-[(E)-but-2-en-2-yl]-1,3-thiazol-2-yl]methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143088073 |
| Molecular Formula | C24H47N3S |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | N-[[5-[(E)-but-2-en-2-yl]-1,3-thiazol-2-yl]methyl]-3-(2-methylpiperidin-1-yl)propan-1-amine;ethane;prop-1-ene |
| SMILES | C/C=C(\C)c1cnc(CNCCCN2CCCCC2C)s1.C=CC.CC.CC |
| InChI | InChI=1S/C17H29N3S.C3H6.2C2H6/c1-4-14(2)16-12-19-17(21-16)13-18-9-7-11-20-10-6-5-8-15(20)3;1-3-2;2*1-2/h4,12,15,18H,5-11,13H2,1-3H3;3H,1H2,2H3;2*1-2H3/b14-4+;;; |
| InChIKey | NTDKWJMATOKLCR-YNEROMMOSA-N |
| XLogP | 7.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|