C16H19N3 — CID 143088257
2-(1,2,3,6-tetrahydropyridin-3-yl)-3a,4,6a,9b-tetrahydro-1H-perimidine (PubChem CID 143088257) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(1,2,3,6-tetrahydropyridin-3-yl)-3a,4,6a,9b-tetrahydro-1H-perimidine.
| Compound Name | 2-(1,2,3,6-tetrahydropyridin-3-yl)-3a,4,6a,9b-tetrahydro-1H-perimidine |
|---|---|
| PubChem CID | 143088257 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(1,2,3,6-tetrahydropyridin-3-yl)-3a,4,6a,9b-tetrahydro-1H-perimidine |
| SMILES | C1=CC2C=CCC3N=C(C4C=CCNC4)NC(=C1)C23 |
| InChI | InChI=1S/C16H19N3/c1-4-11-5-2-8-14-15(11)13(7-1)18-16(19-14)12-6-3-9-17-10-12/h1-7,11-12,14-15,17H,8-10H2,(H,18,19) |
| InChIKey | RNEKUOURBPOUBC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|