C25H31F2NO3 — CID 143089520
3-[2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]-3,4-difluorophenyl]propanoic acid (PubChem CID 143089520) has the molecular formula C25H31F2NO3 and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]-3,4-difluorophenyl]propanoic acid.
| Compound Name | 3-[2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]-3,4-difluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 143089520 |
| Molecular Formula | C25H31F2NO3 |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-[2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]-3,4-difluorophenyl]propanoic acid |
| SMILES | CC(C)(CC1Cc2ccccc2C1)NCCCOc1c(CCC(=O)O)ccc(F)c1F |
| InChI | InChI=1S/C25H31F2NO3/c1-25(2,16-17-14-19-6-3-4-7-20(19)15-17)28-12-5-13-31-24-18(9-11-22(29)30)8-10-21(26)23(24)27/h3-4,6-8,10,17,28H,5,9,11-16H2,1-2H3,(H,29,30) |
| InChIKey | FDLXLVZUPDOEIP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|