C27H36N2O3 — CID 143089521
ethyl (E)-3-[3-amino-2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]prop-2-enoate (PubChem CID 143089521) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is ethyl (E)-3-[3-amino-2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-amino-2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 143089521 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | ethyl (E)-3-[3-amino-2-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(N)c1OCCCNC(C)(C)CC1Cc2ccccc2C1 |
| InChI | InChI=1S/C27H36N2O3/c1-4-31-25(30)14-13-21-11-7-12-24(28)26(21)32-16-8-15-29-27(2,3)19-20-17-22-9-5-6-10-23(22)18-20/h5-7,9-14,20,29H,4,8,15-19,28H2,1-3H3/b14-13+ |
| InChIKey | LCGQYLZOZRFVEU-BUHFOSPRSA-N |
| XLogP | 4.79 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|