C19H21BrN6O2S — CID 143090387
2-aminosulfanyl-1-[4-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]ethanone (PubChem CID 143090387) has the molecular formula C19H21BrN6O2S and a molecular weight of 477.39 g/mol. Its IUPAC name is 2-aminosulfanyl-1-[4-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 2-aminosulfanyl-1-[4-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 143090387 |
| Molecular Formula | C19H21BrN6O2S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-aminosulfanyl-1-[4-[[3-bromo-5-(2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]ethanone |
| SMILES | NSCC(=O)N1CCC(Nc2cc(-c3ccccc3O)nc3c(Br)cnn23)CC1 |
| InChI | InChI=1S/C19H21BrN6O2S/c20-14-10-22-26-17(23-12-5-7-25(8-6-12)18(28)11-29-21)9-15(24-19(14)26)13-3-1-2-4-16(13)27/h1-4,9-10,12,23,27H,5-8,11,21H2 |
| InChIKey | IVEIADYEGNIXEO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|