C24H25BrN6O — CID 88986815
2-[[4-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]methyl]phenol (PubChem CID 88986815) has the molecular formula C24H25BrN6O and a molecular weight of 493.41 g/mol. Its IUPAC name is 2-[[4-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-[[4-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 88986815 |
| Molecular Formula | C24H25BrN6O |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[[4-[[5-(2-aminophenyl)-3-bromopyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidin-1-yl]methyl]phenol |
| SMILES | Nc1ccccc1-c1cc(NC2CCN(Cc3ccccc3O)CC2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C24H25BrN6O/c25-19-14-27-31-23(13-21(29-24(19)31)18-6-2-3-7-20(18)26)28-17-9-11-30(12-10-17)15-16-5-1-4-8-22(16)32/h1-8,13-14,17,28,32H,9-12,15,26H2 |
| InChIKey | DMPKKGJPWDEJAY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|