C22H21BClN5O — CID 89297965
CID 89297965 (PubChem CID 89297965) has the molecular formula C22H21BClN5O and a molecular weight of 417.71 g/mol.
| Compound Name | CID 89297965 |
|---|---|
| PubChem CID | 89297965 |
| Molecular Formula | C22H21BClN5O |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NC3CCN(Cc4ccco4)CC3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C22H21BClN5O/c23-18-13-25-29-21(12-20(27-22(18)29)17-5-1-2-6-19(17)24)26-15-7-9-28(10-8-15)14-16-4-3-11-30-16/h1-6,11-13,15,26H,7-10,14H2 |
| InChIKey | VNKIWHNWCVZGSN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|