C26H25BClN5O — CID 89055292
CID 89055292 (PubChem CID 89055292) has the molecular formula C26H25BClN5O and a molecular weight of 469.79 g/mol.
| Compound Name | CID 89055292 |
|---|---|
| PubChem CID | 89055292 |
| Molecular Formula | C26H25BClN5O |
| Molecular Weight | 469.79 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NC3CCN(C(=O)CCc4ccccc4)CC3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C26H25BClN5O/c27-21-17-29-33-24(16-23(31-26(21)33)20-8-4-5-9-22(20)28)30-19-12-14-32(15-13-19)25(34)11-10-18-6-2-1-3-7-18/h1-9,16-17,19,30H,10-15H2 |
| InChIKey | JQXYSECWNGNJBS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|