C27H25BClN5O — CID 88986692
CID 88986692 (PubChem CID 88986692) has the molecular formula C27H25BClN5O and a molecular weight of 481.80 g/mol.
| Compound Name | CID 88986692 |
|---|---|
| PubChem CID | 88986692 |
| Molecular Formula | C27H25BClN5O |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NC3CCN(C(=O)/C(C)=C/c4ccccc4)CC3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C27H25BClN5O/c1-18(15-19-7-3-2-4-8-19)27(35)33-13-11-20(12-14-33)31-25-16-24(21-9-5-6-10-23(21)29)32-26-22(28)17-30-34(25)26/h2-10,15-17,20,31H,11-14H2,1H3/b18-15+ |
| InChIKey | DKJVTQKPNVVYQP-OBGWFSINSA-N |
| XLogP | 4.35 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|