C25H23BClN5O2 — CID 89055931
CID 89055931 (PubChem CID 89055931) has the molecular formula C25H23BClN5O2 and a molecular weight of 471.76 g/mol.
| Compound Name | CID 89055931 |
|---|---|
| PubChem CID | 89055931 |
| Molecular Formula | C25H23BClN5O2 |
| Molecular Weight | 471.76 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | — |
| SMILES | [B]c1cnn2c(NC3CCN(Cc4ccc5c(c4)OCO5)CC3)cc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C25H23BClN5O2/c26-19-13-28-32-24(12-21(30-25(19)32)18-3-1-2-4-20(18)27)29-17-7-9-31(10-8-17)14-16-5-6-22-23(11-16)34-15-33-22/h1-6,11-13,17,29H,7-10,14-15H2 |
| InChIKey | IKIYVZLTYZBLQQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|