C14H22N4O — CID 143091421
4-(propylamino)-N-pyridin-4-ylpiperidine-1-carboxamide (PubChem CID 143091421) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-(propylamino)-N-pyridin-4-ylpiperidine-1-carboxamide.
| Compound Name | 4-(propylamino)-N-pyridin-4-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 143091421 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-(propylamino)-N-pyridin-4-ylpiperidine-1-carboxamide |
| SMILES | CCCNC1CCN(C(=O)Nc2ccncc2)CC1 |
| InChI | InChI=1S/C14H22N4O/c1-2-7-16-12-5-10-18(11-6-12)14(19)17-13-3-8-15-9-4-13/h3-4,8-9,12,16H,2,5-7,10-11H2,1H3,(H,15,17,19) |
| InChIKey | JPNCOJHAGYGNNX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |