C19H16F3NO3 — CID 143092090
N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-(trifluoromethoxy)phenyl]furan-2-carboxamide (PubChem CID 143092090) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-(trifluoromethoxy)phenyl]furan-2-carboxamide.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-(trifluoromethoxy)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 143092090 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-(trifluoromethoxy)phenyl]furan-2-carboxamide |
| SMILES | C=C/C=C\C(=C/C)NC(=O)c1ccc(-c2cccc(OC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C19H16F3NO3/c1-3-5-8-14(4-2)23-18(24)17-11-10-16(25-17)13-7-6-9-15(12-13)26-19(20,21)22/h3-12H,1H2,2H3,(H,23,24)/b8-5-,14-4+ |
| InChIKey | LRUJWAPSYFKSRH-CQXJEZQLSA-N |
| XLogP | 5.22 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|