C21H24INO5 — CID 143092217
4-[3-(2-iodoacetyl)-5-(1-methoxypropan-2-yloxy)phenoxy]-N,N-dimethylbenzamide (PubChem CID 143092217) has the molecular formula C21H24INO5 and a molecular weight of 497.33 g/mol. Its IUPAC name is 4-[3-(2-iodoacetyl)-5-(1-methoxypropan-2-yloxy)phenoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(2-iodoacetyl)-5-(1-methoxypropan-2-yloxy)phenoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 143092217 |
| Molecular Formula | C21H24INO5 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 4-[3-(2-iodoacetyl)-5-(1-methoxypropan-2-yloxy)phenoxy]-N,N-dimethylbenzamide |
| SMILES | COCC(C)Oc1cc(Oc2ccc(C(=O)N(C)C)cc2)cc(C(=O)CI)c1 |
| InChI | InChI=1S/C21H24INO5/c1-14(13-26-4)27-18-9-16(20(24)12-22)10-19(11-18)28-17-7-5-15(6-8-17)21(25)23(2)3/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | HVXXDCKRVJTSMR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|