C24H30N4O5 — CID 143092235
N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-3-[4-(dimethylcarbamoyl)phenoxy]-5-(1-methoxypropan-2-yloxy)benzamide (PubChem CID 143092235) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-3-[4-(dimethylcarbamoyl)phenoxy]-5-(1-methoxypropan-2-yloxy)benzamide.
| Compound Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-3-[4-(dimethylcarbamoyl)phenoxy]-5-(1-methoxypropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 143092235 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-3-[4-(dimethylcarbamoyl)phenoxy]-5-(1-methoxypropan-2-yloxy)benzamide |
| SMILES | CN/C=C\C(N)=N\C(=O)c1cc(Oc2ccc(C(=O)N(C)C)cc2)cc(OC(C)COC)c1 |
| InChI | InChI=1S/C24H30N4O5/c1-16(15-31-5)32-20-12-18(23(29)27-22(25)10-11-26-2)13-21(14-20)33-19-8-6-17(7-9-19)24(30)28(3)4/h6-14,16,26H,15H2,1-5H3,(H2,25,27,29)/b11-10- |
| InChIKey | RUEBAHNLICBRFI-KHPPLWFESA-N |
| XLogP | 2.82 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|