C19H27N3O6 — CID 143336258
tert-butyl N-[(Z)-3-amino-3-[3-hydroxy-5-(1-methoxypropan-2-yloxy)benzoyl]iminoprop-1-enyl]carbamate (PubChem CID 143336258) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3-amino-3-[3-hydroxy-5-(1-methoxypropan-2-yloxy)benzoyl]iminoprop-1-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-3-amino-3-[3-hydroxy-5-(1-methoxypropan-2-yloxy)benzoyl]iminoprop-1-enyl]carbamate |
|---|---|
| PubChem CID | 143336258 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | tert-butyl N-[(Z)-3-amino-3-[3-hydroxy-5-(1-methoxypropan-2-yloxy)benzoyl]iminoprop-1-enyl]carbamate |
| SMILES | COCC(C)Oc1cc(O)cc(C(=O)/N=C(N)/C=C\NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H27N3O6/c1-12(11-26-5)27-15-9-13(8-14(23)10-15)17(24)22-16(20)6-7-21-18(25)28-19(2,3)4/h6-10,12,23H,11H2,1-5H3,(H,21,25)(H2,20,22,24)/b7-6- |
| InChIKey | GHQDBEUUKFSKPG-SREVYHEPSA-N |
| XLogP | 2.34 |
| TPSA | 132.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|