C23H27N3O5S — CID 143336318
N-[(Z)-1,3-diaminoprop-2-enylidene]-3-(3,4-dihydro-2H-1,5-benzoxathiepin-8-yloxy)-5-(1-methoxypropan-2-yloxy)benzamide (PubChem CID 143336318) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[(Z)-1,3-diaminoprop-2-enylidene]-3-(3,4-dihydro-2H-1,5-benzoxathiepin-8-yloxy)-5-(1-methoxypropan-2-yloxy)benzamide.
| Compound Name | N-[(Z)-1,3-diaminoprop-2-enylidene]-3-(3,4-dihydro-2H-1,5-benzoxathiepin-8-yloxy)-5-(1-methoxypropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 143336318 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[(Z)-1,3-diaminoprop-2-enylidene]-3-(3,4-dihydro-2H-1,5-benzoxathiepin-8-yloxy)-5-(1-methoxypropan-2-yloxy)benzamide |
| SMILES | COCC(C)Oc1cc(Oc2ccc3c(c2)OCCCS3)cc(C(=O)/N=C(N)/C=C\N)c1 |
| InChI | InChI=1S/C23H27N3O5S/c1-15(14-28-2)30-18-10-16(23(27)26-22(25)6-7-24)11-19(12-18)31-17-4-5-21-20(13-17)29-8-3-9-32-21/h4-7,10-13,15H,3,8-9,14,24H2,1-2H3,(H2,25,26,27)/b7-6- |
| InChIKey | RFUUBNCYMLLYHR-SREVYHEPSA-N |
| XLogP | 3.74 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|