C21H26N3O6S+ — CID 143211963
CID 143211963 (PubChem CID 143211963) has the molecular formula C21H26N3O6S+ and a molecular weight of 448.52 g/mol.
| Compound Name | CID 143211963 |
|---|---|
| PubChem CID | 143211963 |
| Molecular Formula | C21H26N3O6S+ |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | — |
| SMILES | CN/C=C\C(N)=N\C(=O)c1cc(Oc2ccc([S+](C)(=O)O)cc2)cc(O[C@@H](C)CO)c1 |
| InChI | InChI=1S/C21H25N3O6S/c1-14(13-25)29-17-10-15(21(26)24-20(22)8-9-23-2)11-18(12-17)30-16-4-6-19(7-5-16)31(3,27)28/h4-12,14,25H,13H2,1-3H3,(H3-,22,23,24,26,27,28)/p+1/t14-/m0/s1 |
| InChIKey | CUGPVJGSNYZOPK-AWEZNQCLSA-O |
| XLogP | 2.43 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|