C16H18O3S — CID 143092224
(3E,5Z)-3-ethenyl-7-(4-methoxysulfanylphenoxy)hepta-3,5-dien-2-one (PubChem CID 143092224) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-7-(4-methoxysulfanylphenoxy)hepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-3-ethenyl-7-(4-methoxysulfanylphenoxy)hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 143092224 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (3E,5Z)-3-ethenyl-7-(4-methoxysulfanylphenoxy)hepta-3,5-dien-2-one |
| SMILES | C=C/C(=C\C=C/COc1ccc(SOC)cc1)C(C)=O |
| InChI | InChI=1S/C16H18O3S/c1-4-14(13(2)17)7-5-6-12-19-15-8-10-16(11-9-15)20-18-3/h4-11H,1,12H2,2-3H3/b6-5-,14-7+ |
| InChIKey | DDQAELPAKXSVFN-NTBKVEBNSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|