C19H21N3O3S2 — CID 143092355
N-[(methylideneamino)carbamothioyl]-3-(4-methylsulfanylphenoxy)-5-propan-2-yloxybenzamide (PubChem CID 143092355) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(methylideneamino)carbamothioyl]-3-(4-methylsulfanylphenoxy)-5-propan-2-yloxybenzamide.
| Compound Name | N-[(methylideneamino)carbamothioyl]-3-(4-methylsulfanylphenoxy)-5-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 143092355 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(methylideneamino)carbamothioyl]-3-(4-methylsulfanylphenoxy)-5-propan-2-yloxybenzamide |
| SMILES | C=NNC(=S)NC(=O)c1cc(Oc2ccc(SC)cc2)cc(OC(C)C)c1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-12(2)24-15-9-13(18(23)21-19(26)22-20-3)10-16(11-15)25-14-5-7-17(27-4)8-6-14/h5-12H,3H2,1-2,4H3,(H2,21,22,23,26) |
| InChIKey | JTZLMESVGNHZTD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|