C17H31NO2 — CID 143093513
ethane;(3Z,6E)-6-(methoxymethyl)-3-methylocta-1,3,6-triene;pyrrolidin-2-one (PubChem CID 143093513) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is ethane;(3Z,6E)-6-(methoxymethyl)-3-methylocta-1,3,6-triene;pyrrolidin-2-one.
| Compound Name | ethane;(3Z,6E)-6-(methoxymethyl)-3-methylocta-1,3,6-triene;pyrrolidin-2-one |
|---|---|
| PubChem CID | 143093513 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | ethane;(3Z,6E)-6-(methoxymethyl)-3-methylocta-1,3,6-triene;pyrrolidin-2-one |
| SMILES | C=C/C(C)=C\C/C(=C\C)COC.CC.O=C1CCCN1 |
| InChI | InChI=1S/C11H18O.C4H7NO.C2H6/c1-5-10(3)7-8-11(6-2)9-12-4;6-4-2-1-3-5-4;1-2/h5-7H,1,8-9H2,2-4H3;1-3H2,(H,5,6);1-2H3/b10-7-,11-6+;; |
| InChIKey | CHDXMBMMQHMHKF-MJADUSSXSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|