C17H33NO2 — CID 142894613
ethane;(4Z,6E)-N-ethyl-6-(propan-2-yloxymethyl)nona-4,6-dienamide (PubChem CID 142894613) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;(4Z,6E)-N-ethyl-6-(propan-2-yloxymethyl)nona-4,6-dienamide.
| Compound Name | ethane;(4Z,6E)-N-ethyl-6-(propan-2-yloxymethyl)nona-4,6-dienamide |
|---|---|
| PubChem CID | 142894613 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | ethane;(4Z,6E)-N-ethyl-6-(propan-2-yloxymethyl)nona-4,6-dienamide |
| SMILES | CC.CC/C=C(\C=C/CCC(=O)NCC)COC(C)C |
| InChI | InChI=1S/C15H27NO2.C2H6/c1-5-9-14(12-18-13(3)4)10-7-8-11-15(17)16-6-2;1-2/h7,9-10,13H,5-6,8,11-12H2,1-4H3,(H,16,17);1-2H3/b10-7-,14-9+; |
| InChIKey | DQDALLFNUBYLQE-RGMJMOJASA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|