C11H17NO2 — CID 91252463
N-[2-(4-methylcyclohexa-2,4-dien-1-yl)oxyethyl]acetamide (PubChem CID 91252463) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[2-(4-methylcyclohexa-2,4-dien-1-yl)oxyethyl]acetamide.
| Compound Name | N-[2-(4-methylcyclohexa-2,4-dien-1-yl)oxyethyl]acetamide |
|---|---|
| PubChem CID | 91252463 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[2-(4-methylcyclohexa-2,4-dien-1-yl)oxyethyl]acetamide |
| SMILES | CC(=O)NCCOC1C=CC(C)=CC1 |
| InChI | InChI=1S/C11H17NO2/c1-9-3-5-11(6-4-9)14-8-7-12-10(2)13/h3-5,11H,6-8H2,1-2H3,(H,12,13) |
| InChIKey | YVMDGLQAQLIRGA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|