C13H20BrNO2 — CID 77217200
N-(4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl)acetamide (PubChem CID 77217200) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is N-(4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl)acetamide.
| Compound Name | N-(4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 77217200 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(4-bromo-6-pentan-3-yloxycyclohexa-2,4-dien-1-yl)acetamide |
| SMILES | CCC(CC)OC1C=C(Br)C=CC1NC(C)=O |
| InChI | InChI=1S/C13H20BrNO2/c1-4-11(5-2)17-13-8-10(14)6-7-12(13)15-9(3)16/h6-8,11-13H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | HCKVPZFMLGNVGJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |