C15H25NO2 — CID 144515567
(4Z,9E)-8-methoxy-4-methyl-1-azacyclotetradeca-4,9-dien-2-one (PubChem CID 144515567) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (4Z,9E)-8-methoxy-4-methyl-1-azacyclotetradeca-4,9-dien-2-one.
| Compound Name | (4Z,9E)-8-methoxy-4-methyl-1-azacyclotetradeca-4,9-dien-2-one |
|---|---|
| PubChem CID | 144515567 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (4Z,9E)-8-methoxy-4-methyl-1-azacyclotetradeca-4,9-dien-2-one |
| SMILES | COC1/C=C/CCCCNC(=O)C/C(C)=C\CC1 |
| InChI | InChI=1S/C15H25NO2/c1-13-8-7-10-14(18-2)9-5-3-4-6-11-16-15(17)12-13/h5,8-9,14H,3-4,6-7,10-12H2,1-2H3,(H,16,17)/b9-5+,13-8- |
| InChIKey | NWYCFTXIPZQJLT-VONIIWBQSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|