C15H25NO3 — CID 144515533
(5Z,10E)-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one (PubChem CID 144515533) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (5Z,10E)-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one.
| Compound Name | (5Z,10E)-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 144515533 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (5Z,10E)-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one |
| SMILES | COC1/C=C/CCCOC(=O)NC/C(C)=C\C(C)C1 |
| InChI | InChI=1S/C15H25NO3/c1-12-9-13(2)11-16-15(17)19-8-6-4-5-7-14(10-12)18-3/h5,7,9,12,14H,4,6,8,10-11H2,1-3H3,(H,16,17)/b7-5+,13-9- |
| InChIKey | BHTMCEPPDSWEDV-HUZLQASOSA-N |
| XLogP | 3.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|