C16H26O3 — CID 90873235
(5R,6S,7S)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8,12-trien-6-ol (PubChem CID 90873235) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (5R,6S,7S)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8,12-trien-6-ol.
| Compound Name | (5R,6S,7S)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8,12-trien-6-ol |
|---|---|
| PubChem CID | 90873235 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (5R,6S,7S)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8,12-trien-6-ol |
| SMILES | CO[C@H]1C=CCCC=CCOCC(C)=C[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C16H26O3/c1-13-11-14(2)16(17)15(18-3)9-7-5-4-6-8-10-19-12-13/h6-9,11,14-17H,4-5,10,12H2,1-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | JJCRJBVNOIMNHG-PMPSAXMXSA-N |
| XLogP | 2.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|