C17H30O3 — CID 67992687
(1S,2R,3Z,12E)-14-methoxy-2,4-dimethylcyclotetradeca-3,12-diene-1,7-diol (PubChem CID 67992687) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (1S,2R,3Z,12E)-14-methoxy-2,4-dimethylcyclotetradeca-3,12-diene-1,7-diol.
| Compound Name | (1S,2R,3Z,12E)-14-methoxy-2,4-dimethylcyclotetradeca-3,12-diene-1,7-diol |
|---|---|
| PubChem CID | 67992687 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (1S,2R,3Z,12E)-14-methoxy-2,4-dimethylcyclotetradeca-3,12-diene-1,7-diol |
| SMILES | COC1/C=C/CCCCC(O)CC/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H30O3/c1-13-10-11-15(18)8-6-4-5-7-9-16(20-3)17(19)14(2)12-13/h7,9,12,14-19H,4-6,8,10-11H2,1-3H3/b9-7+,13-12-/t14-,15?,16?,17+/m1/s1 |
| InChIKey | GUNQQIFKLKWFEK-KJDPASESSA-N |
| XLogP | 3.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|