C15H22O4 — CID 24859784
(2E,4Z,6S,7S,8S,9E)-6,7-dihydroxy-8-methoxycyclotetradeca-2,4,9-trien-1-one (PubChem CID 24859784) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2E,4Z,6S,7S,8S,9E)-6,7-dihydroxy-8-methoxycyclotetradeca-2,4,9-trien-1-one.
| Compound Name | (2E,4Z,6S,7S,8S,9E)-6,7-dihydroxy-8-methoxycyclotetradeca-2,4,9-trien-1-one |
|---|---|
| PubChem CID | 24859784 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2E,4Z,6S,7S,8S,9E)-6,7-dihydroxy-8-methoxycyclotetradeca-2,4,9-trien-1-one |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)/C=C/C=C\[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22O4/c1-19-14-11-5-3-2-4-8-12(16)9-6-7-10-13(17)15(14)18/h5-7,9-11,13-15,17-18H,2-4,8H2,1H3/b9-6+,10-7-,11-5+/t13-,14-,15-/m0/s1 |
| InChIKey | XDHCHNNQIUQXKF-REUTVILYSA-N |
| XLogP | 1.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|