C19H27F3O5 — CID 66563295
2-[[(3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-yl]oxy]acetic acid (PubChem CID 66563295) has the molecular formula C19H27F3O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[[(3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-yl]oxy]acetic acid.
| Compound Name | 2-[[(3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 66563295 |
| Molecular Formula | C19H27F3O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[[(3Z,5R,6S,7S,8E,12Z)-7-methoxy-3,5-dimethyl-12-(trifluoromethyl)-1-oxacyclotetradeca-3,8,12-trien-6-yl]oxy]acetic acid |
| SMILES | CO[C@H]1/C=C/CC/C(C(F)(F)F)=C/COC/C(C)=C\[C@@H](C)[C@@H]1OCC(=O)O |
| InChI | InChI=1S/C19H27F3O5/c1-13-10-14(2)18(27-12-17(23)24)16(25-3)7-5-4-6-15(19(20,21)22)8-9-26-11-13/h5,7-8,10,14,16,18H,4,6,9,11-12H2,1-3H3,(H,23,24)/b7-5+,13-10-,15-8-/t14-,16+,18+/m1/s1 |
| InChIKey | SVIAWHBZYDPNBU-SEDNSUGXSA-N |
| XLogP | 3.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|