C26H49NO5Si — CID 71236142
tert-butyl (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene-4-carboxylate (PubChem CID 71236142) has the molecular formula C26H49NO5Si and a molecular weight of 483.77 g/mol. Its IUPAC name is tert-butyl (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene-4-carboxylate.
| Compound Name | tert-butyl (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene-4-carboxylate |
|---|---|
| PubChem CID | 71236142 |
| Molecular Formula | C26H49NO5Si |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 483.34 |
| IUPAC Name | tert-butyl (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxa-4-azacyclotetradeca-7,12-diene-4-carboxylate |
| SMILES | CO[C@H]1/C=C/CCN(C(=O)OC(C)(C)C)CCOC/C(C)=C\C(C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49NO5Si/c1-20-18-21(2)23(32-33(10,11)26(6,7)8)22(29-9)14-12-13-15-27(16-17-30-19-20)24(28)31-25(3,4)5/h12,14,18,21-23H,13,15-17,19H2,1-11H3/b14-12+,20-18-/t21?,22-,23-/m0/s1 |
| InChIKey | JBAIWTQPUOGRPU-IMRUEBPZSA-N |
| XLogP | 6.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|