C11H19NO3 — CID 14868063
tert-butyl 6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 14868063) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl 6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 14868063 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | tert-butyl 6-methoxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC1C=CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(13)12-8-6-5-7-9(12)14-4/h5,7,9H,6,8H2,1-4H3 |
| InChIKey | HTHXBPSZVRRBFZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|