C16H29NO — CID 144515512
(4Z,9E)-8-methoxy-4-methylcyclotetradeca-4,9-dien-1-amine (PubChem CID 144515512) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (4Z,9E)-8-methoxy-4-methylcyclotetradeca-4,9-dien-1-amine.
| Compound Name | (4Z,9E)-8-methoxy-4-methylcyclotetradeca-4,9-dien-1-amine |
|---|---|
| PubChem CID | 144515512 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (4Z,9E)-8-methoxy-4-methylcyclotetradeca-4,9-dien-1-amine |
| SMILES | COC1/C=C/CCCCC(N)CC/C(C)=C\CC1 |
| InChI | InChI=1S/C16H29NO/c1-14-8-7-11-16(18-2)10-6-4-3-5-9-15(17)13-12-14/h6,8,10,15-16H,3-5,7,9,11-13,17H2,1-2H3/b10-6+,14-8- |
| InChIKey | IIVBWRCZQLYPML-UUIXNEETSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|