C12H21NO — CID 166967627
[(1Z,7E)-4-amino-7-methylcyclodeca-1,7-dien-1-yl]methanol (PubChem CID 166967627) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is [(1Z,7E)-4-amino-7-methylcyclodeca-1,7-dien-1-yl]methanol.
| Compound Name | [(1Z,7E)-4-amino-7-methylcyclodeca-1,7-dien-1-yl]methanol |
|---|---|
| PubChem CID | 166967627 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | [(1Z,7E)-4-amino-7-methylcyclodeca-1,7-dien-1-yl]methanol |
| SMILES | C/C1=C\CC/C(CO)=C/CC(N)CC1 |
| InChI | InChI=1S/C12H21NO/c1-10-3-2-4-11(9-14)6-8-12(13)7-5-10/h3,6,12,14H,2,4-5,7-9,13H2,1H3/b10-3+,11-6- |
| InChIKey | NGBLBACIGJHKFG-MPUMUABYSA-N |
| XLogP | 2.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|